C9H8ClNO5S2 — CID 94322789
(2S)-1-(5-chlorothiophen-2-yl)sulfonyl-4-oxopyrrolidine-2-carboxylic acid (PubChem CID 94322789) has the molecular formula C9H8ClNO5S2 and a molecular weight of 309.75 g/mol. Its IUPAC name is (2S)-1-(5-chlorothiophen-2-yl)sulfonyl-4-oxopyrrolidine-2-carboxylic acid.
| Compound Name | (2S)-1-(5-chlorothiophen-2-yl)sulfonyl-4-oxopyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 94322789 |
| Molecular Formula | C9H8ClNO5S2 |
| Molecular Weight | 309.75 g/mol |
| Exact Mass | 308.95 |
| IUPAC Name | (2S)-1-(5-chlorothiophen-2-yl)sulfonyl-4-oxopyrrolidine-2-carboxylic acid |
| SMILES | O=C1C[C@@H](C(=O)O)N(S(=O)(=O)c2ccc(Cl)s2)C1 |
| InChI | InChI=1S/C9H8ClNO5S2/c10-7-1-2-8(17-7)18(15,16)11-4-5(12)3-6(11)9(13)14/h1-2,6H,3-4H2,(H,13,14)/t6-/m0/s1 |
| InChIKey | NXRPMTXTFNCVRR-LURJTMIESA-N |
| XLogP | 0.82 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.75 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |