C10H14ClNO4S2 — CID 81219101
[4-(5-chlorothiophen-2-yl)sulfonyl-5-methylmorpholin-2-yl]methanol (PubChem CID 81219101) has the molecular formula C10H14ClNO4S2 and a molecular weight of 311.81 g/mol. Its IUPAC name is [4-(5-chlorothiophen-2-yl)sulfonyl-5-methylmorpholin-2-yl]methanol.
| Compound Name | [4-(5-chlorothiophen-2-yl)sulfonyl-5-methylmorpholin-2-yl]methanol |
|---|---|
| PubChem CID | 81219101 |
| Molecular Formula | C10H14ClNO4S2 |
| Molecular Weight | 311.81 g/mol |
| Exact Mass | 311.01 |
| IUPAC Name | [4-(5-chlorothiophen-2-yl)sulfonyl-5-methylmorpholin-2-yl]methanol |
| SMILES | CC1COC(CO)CN1S(=O)(=O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C10H14ClNO4S2/c1-7-6-16-8(5-13)4-12(7)18(14,15)10-3-2-9(11)17-10/h2-3,7-8,13H,4-6H2,1H3 |
| InChIKey | TVEFLXZCGYLBKA-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.81 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |