C25H23F4N3O2 — CID 59681333
3-[4-fluoro-3-(trifluoromethyl)phenyl]-1-[5-(4-isocyanophenyl)-2-bicyclo[3.1.0]hexanyl]-1-(4-oxobutyl)urea (PubChem CID 59681333) has the molecular formula C25H23F4N3O2 and a molecular weight of 473.47 g/mol. Its IUPAC name is 3-[4-fluoro-3-(trifluoromethyl)phenyl]-1-[5-(4-isocyanophenyl)-2-bicyclo[3.1.0]hexanyl]-1-(4-oxobutyl)urea.
| Compound Name | 3-[4-fluoro-3-(trifluoromethyl)phenyl]-1-[5-(4-isocyanophenyl)-2-bicyclo[3.1.0]hexanyl]-1-(4-oxobutyl)urea |
|---|---|
| PubChem CID | 59681333 |
| Molecular Formula | C25H23F4N3O2 |
| Molecular Weight | 473.47 g/mol |
| Exact Mass | 473.17 |
| IUPAC Name | 3-[4-fluoro-3-(trifluoromethyl)phenyl]-1-[5-(4-isocyanophenyl)-2-bicyclo[3.1.0]hexanyl]-1-(4-oxobutyl)urea |
| SMILES | [C-]#[N+]c1ccc(C23CCC(N(CCCC=O)C(=O)Nc4ccc(F)c(C(F)(F)F)c4)C2C3)cc1 |
| InChI | InChI=1S/C25H23F4N3O2/c1-30-17-6-4-16(5-7-17)24-11-10-22(20(24)15-24)32(12-2-3-13-33)23(34)31-18-8-9-21(26)19(14-18)25(27,28)29/h4-9,13-14,20,22H,2-3,10-12,15H2,(H,31,34) |
| InChIKey | YKSYGEYVFSLZQV-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 53.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.47 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|