C32H32ClN3O2S — CID 59683563
3-chloro-N-[[2-ethoxy-5-(4-isocyanophenyl)phenyl]methyl]-N-[4-(methylamino)cyclohexyl]-1-benzothiophene-2-carboxamide (PubChem CID 59683563) has the molecular formula C32H32ClN3O2S and a molecular weight of 558.15 g/mol. Its IUPAC name is 3-chloro-N-[[2-ethoxy-5-(4-isocyanophenyl)phenyl]methyl]-N-[4-(methylamino)cyclohexyl]-1-benzothiophene-2-carboxamide.
| Compound Name | 3-chloro-N-[[2-ethoxy-5-(4-isocyanophenyl)phenyl]methyl]-N-[4-(methylamino)cyclohexyl]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 59683563 |
| Molecular Formula | C32H32ClN3O2S |
| Molecular Weight | 558.15 g/mol |
| Exact Mass | 557.19 |
| IUPAC Name | 3-chloro-N-[[2-ethoxy-5-(4-isocyanophenyl)phenyl]methyl]-N-[4-(methylamino)cyclohexyl]-1-benzothiophene-2-carboxamide |
| SMILES | [C-]#[N+]c1ccc(-c2ccc(OCC)c(CN(C(=O)c3sc4ccccc4c3Cl)C3CCC(NC)CC3)c2)cc1 |
| InChI | InChI=1S/C32H32ClN3O2S/c1-4-38-28-18-11-22(21-9-12-24(34-2)13-10-21)19-23(28)20-36(26-16-14-25(35-3)15-17-26)32(37)31-30(33)27-7-5-6-8-29(27)39-31/h5-13,18-19,25-26,35H,4,14-17,20H2,1,3H3 |
| InChIKey | QKZBROUXZISVPX-UHFFFAOYSA-N |
| XLogP | 8.34 |
| TPSA | 45.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.15 |
| LogP ≤ 5 | 8.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|