C24H26ClIN2O2S — CID 67585507
3-chloro-N-[(3-iodo-4-methoxyphenyl)methyl]-N-[4-(methylamino)cyclohexyl]-1-benzothiophene-2-carboxamide (PubChem CID 67585507) has the molecular formula C24H26ClIN2O2S and a molecular weight of 568.91 g/mol. Its IUPAC name is 3-chloro-N-[(3-iodo-4-methoxyphenyl)methyl]-N-[4-(methylamino)cyclohexyl]-1-benzothiophene-2-carboxamide.
| Compound Name | 3-chloro-N-[(3-iodo-4-methoxyphenyl)methyl]-N-[4-(methylamino)cyclohexyl]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 67585507 |
| Molecular Formula | C24H26ClIN2O2S |
| Molecular Weight | 568.91 g/mol |
| Exact Mass | 568.04 |
| IUPAC Name | 3-chloro-N-[(3-iodo-4-methoxyphenyl)methyl]-N-[4-(methylamino)cyclohexyl]-1-benzothiophene-2-carboxamide |
| SMILES | CNC1CCC(N(Cc2ccc(OC)c(I)c2)C(=O)c2sc3ccccc3c2Cl)CC1 |
| InChI | InChI=1S/C24H26ClIN2O2S/c1-27-16-8-10-17(11-9-16)28(14-15-7-12-20(30-2)19(26)13-15)24(29)23-22(25)18-5-3-4-6-21(18)31-23/h3-7,12-13,16-17,27H,8-11,14H2,1-2H3 |
| InChIKey | YSMSQPVHLQJHRZ-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.91 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|