C21H20N6O2 — CID 59684400
[5-(5-isocyano-2-pyridinyl)-1-pyridin-3-ylpyrazol-3-yl]-(4-methoxypiperidin-1-yl)methanone (PubChem CID 59684400) has the molecular formula C21H20N6O2 and a molecular weight of 388.43 g/mol. Its IUPAC name is [5-(5-isocyano-2-pyridinyl)-1-pyridin-3-ylpyrazol-3-yl]-(4-methoxypiperidin-1-yl)methanone.
| Compound Name | [5-(5-isocyano-2-pyridinyl)-1-pyridin-3-ylpyrazol-3-yl]-(4-methoxypiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 59684400 |
| Molecular Formula | C21H20N6O2 |
| Molecular Weight | 388.43 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | [5-(5-isocyano-2-pyridinyl)-1-pyridin-3-ylpyrazol-3-yl]-(4-methoxypiperidin-1-yl)methanone |
| SMILES | [C-]#[N+]c1ccc(-c2cc(C(=O)N3CCC(OC)CC3)nn2-c2cccnc2)nc1 |
| InChI | InChI=1S/C21H20N6O2/c1-22-15-5-6-18(24-13-15)20-12-19(25-27(20)16-4-3-9-23-14-16)21(28)26-10-7-17(29-2)8-11-26/h3-6,9,12-14,17H,7-8,10-11H2,2H3 |
| InChIKey | KDLFDVRSRPRXRM-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 77.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.43 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|