About chloroplatinum(1+);1-methyl-5,7-bis(pyrazol-1-ylmethyl)-6H-pyrrolo[1,2-a]imidazol-6-ide
chloroplatinum(1+);1-methyl-5,7-bis(pyrazol-1-ylmethyl)-6H-pyrrolo[1,2-a]imidazol-6-ide (PubChem CID 59685596) has the molecular formula C15H15ClN6Pt
and a molecular weight of 509.86 g/mol. Its IUPAC name is chloroplatinum(1+);1-methyl-5,7-bis(pyrazol-1-ylmethyl)-6H-pyrrolo[1,2-a]imidazol-6-ide.
Molecular Properties
| Compound Name | chloroplatinum(1+);1-methyl-5,7-bis(pyrazol-1-ylmethyl)-6H-pyrrolo[1,2-a]imidazol-6-ide |
| PubChem CID | 59685596 |
| Molecular Formula | C15H15ClN6Pt |
| Molecular Weight | 509.86 g/mol |
| Exact Mass | 509.07 |
| IUPAC Name | chloroplatinum(1+);1-methyl-5,7-bis(pyrazol-1-ylmethyl)-6H-pyrrolo[1,2-a]imidazol-6-ide |
| SMILES | Cl[Pt+].Cn1ccn2c(Cn3cccn3)[c-]c(Cn3cccn3)c12 |
| InChI | InChI=1S/C15H15N6.ClH.Pt/c1-18-8-9-21-14(12-20-7-3-5-17-20)10-13(15(18)21)11-19-6-2-4-16-19;;/h2-9H,11-12H2,1H3;1H;/q-1;;+2/p-1 |
| InChIKey | REGSHNJYQCKXKS-UHFFFAOYSA-M |
| XLogP | 2.25 |
| TPSA | 44.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 509.86 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze chloroplatinum(1+);1-methyl-5,7-bis(pyrazol-1-ylmethyl)-6H-pyrrolo[1,2-a]imidazol-6-ide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloroplatinum(1+);1-methyl-5,7-bis(pyrazol-1-ylmethyl)-6H-pyrrolo[1,2-a]imidazol-6-ide?
The IUPAC name of chloroplatinum(1+);1-methyl-5,7-bis(pyrazol-1-ylmethyl)-6H-pyrrolo[1,2-a]imidazol-6-ide (CID 59685596) is chloroplatinum(1+);1-methyl-5,7-bis(pyrazol-1-ylmethyl)-6H-pyrrolo[1,2-a]imidazol-6-ide.
What is the SMILES notation for chloroplatinum(1+);1-methyl-5,7-bis(pyrazol-1-ylmethyl)-6H-pyrrolo[1,2-a]imidazol-6-ide?
The canonical SMILES for chloroplatinum(1+);1-methyl-5,7-bis(pyrazol-1-ylmethyl)-6H-pyrrolo[1,2-a]imidazol-6-ide is Cl[Pt+].Cn1ccn2c(Cn3cccn3)[c-]c(Cn3cccn3)c12.
What is the InChIKey of chloroplatinum(1+);1-methyl-5,7-bis(pyrazol-1-ylmethyl)-6H-pyrrolo[1,2-a]imidazol-6-ide?
The InChIKey is REGSHNJYQCKXKS-UHFFFAOYSA-M. The full InChI is InChI=1S/C15H15N6.ClH.Pt/c1-18-8-9-21-14(12-20-7-3-5-17-20)10-13(15(18)21)11-19-6-2-4-16-19;;/h2-9H,11-12H2,1H3;1H;/q-1;;+2/p-1.
What are the key properties of chloroplatinum(1+);1-methyl-5,7-bis(pyrazol-1-ylmethyl)-6H-pyrrolo[1,2-a]imidazol-6-ide?
chloroplatinum(1+);1-methyl-5,7-bis(pyrazol-1-ylmethyl)-6H-pyrrolo[1,2-a]imidazol-6-ide has a molecular weight of 509.86 g/mol, XLogP of 2.25, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for chloroplatinum(1+);1-methyl-5,7-bis(pyrazol-1-ylmethyl)-6H-pyrrolo[1,2-a]imidazol-6-ide is sourced from PubChem (CID 59685596), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).