C14H13ClN4Pt — CID 59685664
chloroplatinum(1+);1-[[3-(pyrazol-1-ylmethyl)benzene-2-id-1-yl]methyl]pyrazole (PubChem CID 59685664) has the molecular formula C14H13ClN4Pt and a molecular weight of 467.82 g/mol. Its IUPAC name is chloroplatinum(1+);1-[[3-(pyrazol-1-ylmethyl)benzene-2-id-1-yl]methyl]pyrazole.
| Compound Name | chloroplatinum(1+);1-[[3-(pyrazol-1-ylmethyl)benzene-2-id-1-yl]methyl]pyrazole |
|---|---|
| PubChem CID | 59685664 |
| Molecular Formula | C14H13ClN4Pt |
| Molecular Weight | 467.82 g/mol |
| Exact Mass | 467.05 |
| IUPAC Name | chloroplatinum(1+);1-[[3-(pyrazol-1-ylmethyl)benzene-2-id-1-yl]methyl]pyrazole |
| SMILES | Cl[Pt+].[c-]1c(Cn2cccn2)cccc1Cn1cccn1 |
| InChI | InChI=1S/C14H13N4.ClH.Pt/c1-4-13(11-17-8-2-6-15-17)10-14(5-1)12-18-9-3-7-16-18;;/h1-9H,11-12H2;1H;/q-1;;+2/p-1 |
| InChIKey | NQXZRGCFUZEKRE-UHFFFAOYSA-M |
| XLogP | 2.66 |
| TPSA | 35.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.82 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|