C10H7F2IrN2- — CID 59757586
1-[(2,5-difluorobenzene-6-id-1-yl)methyl]pyrazole;iridium (PubChem CID 59757586) has the molecular formula C10H7F2IrN2- and a molecular weight of 385.39 g/mol. Its IUPAC name is 1-[(2,5-difluorobenzene-6-id-1-yl)methyl]pyrazole;iridium.
| Compound Name | 1-[(2,5-difluorobenzene-6-id-1-yl)methyl]pyrazole;iridium |
|---|---|
| PubChem CID | 59757586 |
| Molecular Formula | C10H7F2IrN2- |
| Molecular Weight | 385.39 g/mol |
| Exact Mass | 386.02 |
| IUPAC Name | 1-[(2,5-difluorobenzene-6-id-1-yl)methyl]pyrazole;iridium |
| SMILES | Fc1[c-]c(Cn2cccn2)c(F)cc1.[Ir] |
| InChI | InChI=1S/C10H7F2N2.Ir/c11-9-2-3-10(12)8(6-9)7-14-5-1-4-13-14;/h1-5H,7H2;/q-1; |
| InChIKey | VSEADOGRVQWEML-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.39 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|