C10H7F2N2- — CID 102405545
1-[(2,4-difluorobenzene-6-id-1-yl)methyl]pyrazole (PubChem CID 102405545) has the molecular formula C10H7F2N2- and a molecular weight of 193.18 g/mol. Its IUPAC name is 1-[(2,4-difluorobenzene-6-id-1-yl)methyl]pyrazole.
| Compound Name | 1-[(2,4-difluorobenzene-6-id-1-yl)methyl]pyrazole |
|---|---|
| PubChem CID | 102405545 |
| Molecular Formula | C10H7F2N2- |
| Molecular Weight | 193.18 g/mol |
| Exact Mass | 193.06 |
| IUPAC Name | 1-[(2,4-difluorobenzene-6-id-1-yl)methyl]pyrazole |
| SMILES | Fc1c[c-]c(Cn2cccn2)c(F)c1 |
| InChI | InChI=1S/C10H7F2N2/c11-9-3-2-8(10(12)6-9)7-14-5-1-4-13-14/h1,3-6H,7H2/q-1 |
| InChIKey | WCNUPJBMRNWVFU-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.18 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|