About chloroplatinum(1+);1-[[1-methyl-2-(pyrazol-1-ylmethyl)-3H-pyrrol-3-id-4-yl]methyl]pyrazole
chloroplatinum(1+);1-[[1-methyl-2-(pyrazol-1-ylmethyl)-3H-pyrrol-3-id-4-yl]methyl]pyrazole (PubChem CID 59685562) has the molecular formula C13H14ClN5Pt
and a molecular weight of 470.82 g/mol. Its IUPAC name is chloroplatinum(1+);1-[[1-methyl-2-(pyrazol-1-ylmethyl)-3H-pyrrol-3-id-4-yl]methyl]pyrazole.
Molecular Properties
| Compound Name | chloroplatinum(1+);1-[[1-methyl-2-(pyrazol-1-ylmethyl)-3H-pyrrol-3-id-4-yl]methyl]pyrazole |
| PubChem CID | 59685562 |
| Molecular Formula | C13H14ClN5Pt |
| Molecular Weight | 470.82 g/mol |
| Exact Mass | 470.06 |
| IUPAC Name | chloroplatinum(1+);1-[[1-methyl-2-(pyrazol-1-ylmethyl)-3H-pyrrol-3-id-4-yl]methyl]pyrazole |
| SMILES | Cl[Pt+].Cn1cc(Cn2cccn2)[c-]c1Cn1cccn1 |
| InChI | InChI=1S/C13H14N5.ClH.Pt/c1-16-9-12(10-17-6-2-4-14-17)8-13(16)11-18-7-3-5-15-18;;/h2-7,9H,10-11H2,1H3;1H;/q-1;;+2/p-1 |
| InChIKey | DPPVZEHIPHOFDK-UHFFFAOYSA-M |
| XLogP | 2.00 |
| TPSA | 40.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 470.82 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze chloroplatinum(1+);1-[[1-methyl-2-(pyrazol-1-ylmethyl)-3H-pyrrol-3-id-4-yl]methyl]pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloroplatinum(1+);1-[[1-methyl-2-(pyrazol-1-ylmethyl)-3H-pyrrol-3-id-4-yl]methyl]pyrazole?
The IUPAC name of chloroplatinum(1+);1-[[1-methyl-2-(pyrazol-1-ylmethyl)-3H-pyrrol-3-id-4-yl]methyl]pyrazole (CID 59685562) is chloroplatinum(1+);1-[[1-methyl-2-(pyrazol-1-ylmethyl)-3H-pyrrol-3-id-4-yl]methyl]pyrazole.
What is the SMILES notation for chloroplatinum(1+);1-[[1-methyl-2-(pyrazol-1-ylmethyl)-3H-pyrrol-3-id-4-yl]methyl]pyrazole?
The canonical SMILES for chloroplatinum(1+);1-[[1-methyl-2-(pyrazol-1-ylmethyl)-3H-pyrrol-3-id-4-yl]methyl]pyrazole is Cl[Pt+].Cn1cc(Cn2cccn2)[c-]c1Cn1cccn1.
What is the InChIKey of chloroplatinum(1+);1-[[1-methyl-2-(pyrazol-1-ylmethyl)-3H-pyrrol-3-id-4-yl]methyl]pyrazole?
The InChIKey is DPPVZEHIPHOFDK-UHFFFAOYSA-M. The full InChI is InChI=1S/C13H14N5.ClH.Pt/c1-16-9-12(10-17-6-2-4-14-17)8-13(16)11-18-7-3-5-15-18;;/h2-7,9H,10-11H2,1H3;1H;/q-1;;+2/p-1.
What are the key properties of chloroplatinum(1+);1-[[1-methyl-2-(pyrazol-1-ylmethyl)-3H-pyrrol-3-id-4-yl]methyl]pyrazole?
chloroplatinum(1+);1-[[1-methyl-2-(pyrazol-1-ylmethyl)-3H-pyrrol-3-id-4-yl]methyl]pyrazole has a molecular weight of 470.82 g/mol, XLogP of 2.00, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for chloroplatinum(1+);1-[[1-methyl-2-(pyrazol-1-ylmethyl)-3H-pyrrol-3-id-4-yl]methyl]pyrazole is sourced from PubChem (CID 59685562), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).