C25H24N4O — CID 59688697
[3-amino-4-(1H-indol-5-yl)phenyl]-(2-methyl-1,2,3,4-tetrahydro-1,5-benzodiazepin-5-yl)methanone (PubChem CID 59688697) has the molecular formula C25H24N4O and a molecular weight of 396.49 g/mol. Its IUPAC name is [3-amino-4-(1H-indol-5-yl)phenyl]-(2-methyl-1,2,3,4-tetrahydro-1,5-benzodiazepin-5-yl)methanone.
| Compound Name | [3-amino-4-(1H-indol-5-yl)phenyl]-(2-methyl-1,2,3,4-tetrahydro-1,5-benzodiazepin-5-yl)methanone |
|---|---|
| PubChem CID | 59688697 |
| Molecular Formula | C25H24N4O |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | [3-amino-4-(1H-indol-5-yl)phenyl]-(2-methyl-1,2,3,4-tetrahydro-1,5-benzodiazepin-5-yl)methanone |
| SMILES | CC1CCN(C(=O)c2ccc(-c3ccc4[nH]ccc4c3)c(N)c2)c2ccccc2N1 |
| InChI | InChI=1S/C25H24N4O/c1-16-11-13-29(24-5-3-2-4-23(24)28-16)25(30)19-6-8-20(21(26)15-19)17-7-9-22-18(14-17)10-12-27-22/h2-10,12,14-16,27-28H,11,13,26H2,1H3 |
| InChIKey | ZLCPYANDFVAWDS-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 74.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|