C33H38N4O3 — CID 59688733
[4-(1H-indol-5-yl)-3-(4-morpholin-4-ylbutoxy)phenyl]-[(2S)-2-methyl-1,2,3,4-tetrahydro-1,5-benzodiazepin-5-yl]methanone (PubChem CID 59688733) has the molecular formula C33H38N4O3 and a molecular weight of 538.69 g/mol. Its IUPAC name is [4-(1H-indol-5-yl)-3-(4-morpholin-4-ylbutoxy)phenyl]-[(2S)-2-methyl-1,2,3,4-tetrahydro-1,5-benzodiazepin-5-yl]methanone.
| Compound Name | [4-(1H-indol-5-yl)-3-(4-morpholin-4-ylbutoxy)phenyl]-[(2S)-2-methyl-1,2,3,4-tetrahydro-1,5-benzodiazepin-5-yl]methanone |
|---|---|
| PubChem CID | 59688733 |
| Molecular Formula | C33H38N4O3 |
| Molecular Weight | 538.69 g/mol |
| Exact Mass | 538.29 |
| IUPAC Name | [4-(1H-indol-5-yl)-3-(4-morpholin-4-ylbutoxy)phenyl]-[(2S)-2-methyl-1,2,3,4-tetrahydro-1,5-benzodiazepin-5-yl]methanone |
| SMILES | C[C@H]1CCN(C(=O)c2ccc(-c3ccc4[nH]ccc4c3)c(OCCCCN3CCOCC3)c2)c2ccccc2N1 |
| InChI | InChI=1S/C33H38N4O3/c1-24-13-16-37(31-7-3-2-6-30(31)35-24)33(38)27-8-10-28(25-9-11-29-26(22-25)12-14-34-29)32(23-27)40-19-5-4-15-36-17-20-39-21-18-36/h2-3,6-12,14,22-24,34-35H,4-5,13,15-21H2,1H3/t24-/m0/s1 |
| InChIKey | UEQKXEIPGQVIPK-DEOSSOPVSA-N |
| XLogP | 6.18 |
| TPSA | 69.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.69 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|