C17H24NO3- — CID 59689048
[3-[3,6-dimethyl-2-(2-methyl-4-oxopentan-2-yl)phenoxy]-3-oxopropyl]azanide (PubChem CID 59689048) has the molecular formula C17H24NO3- and a molecular weight of 290.38 g/mol. Its IUPAC name is [3-[3,6-dimethyl-2-(2-methyl-4-oxopentan-2-yl)phenoxy]-3-oxopropyl]azanide.
| Compound Name | [3-[3,6-dimethyl-2-(2-methyl-4-oxopentan-2-yl)phenoxy]-3-oxopropyl]azanide |
|---|---|
| PubChem CID | 59689048 |
| Molecular Formula | C17H24NO3- |
| Molecular Weight | 290.38 g/mol |
| Exact Mass | 290.18 |
| IUPAC Name | [3-[3,6-dimethyl-2-(2-methyl-4-oxopentan-2-yl)phenoxy]-3-oxopropyl]azanide |
| SMILES | CC(=O)CC(C)(C)c1c(C)ccc(C)c1OC(=O)CC[NH-] |
| InChI | InChI=1S/C17H24NO3/c1-11-6-7-12(2)16(21-14(20)8-9-18)15(11)17(4,5)10-13(3)19/h6-7,18H,8-10H2,1-5H3/q-1 |
| InChIKey | FJMLAESQZDYSSE-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 67.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.38 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|