C23H27ClN6O — CID 59689677
N-(4-chlorophenyl)-4-[N-cyano-N'-(4-methylphenyl)carbamimidoyl]-3-propan-2-ylpiperazine-1-carboxamide (PubChem CID 59689677) has the molecular formula C23H27ClN6O and a molecular weight of 438.96 g/mol. Its IUPAC name is N-(4-chlorophenyl)-4-[N-cyano-N'-(4-methylphenyl)carbamimidoyl]-3-propan-2-ylpiperazine-1-carboxamide.
| Compound Name | N-(4-chlorophenyl)-4-[N-cyano-N'-(4-methylphenyl)carbamimidoyl]-3-propan-2-ylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 59689677 |
| Molecular Formula | C23H27ClN6O |
| Molecular Weight | 438.96 g/mol |
| Exact Mass | 438.19 |
| IUPAC Name | N-(4-chlorophenyl)-4-[N-cyano-N'-(4-methylphenyl)carbamimidoyl]-3-propan-2-ylpiperazine-1-carboxamide |
| SMILES | Cc1ccc(/N=C(\NC#N)N2CCN(C(=O)Nc3ccc(Cl)cc3)CC2C(C)C)cc1 |
| InChI | InChI=1S/C23H27ClN6O/c1-16(2)21-14-29(23(31)28-20-10-6-18(24)7-11-20)12-13-30(21)22(26-15-25)27-19-8-4-17(3)5-9-19/h4-11,16,21H,12-14H2,1-3H3,(H,26,27)(H,28,31) |
| InChIKey | FBQNWTKCRMJGBP-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 83.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.96 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|