C26H25ClN6O — CID 23649368
N-(4-chlorophenyl)-4-[N-cyano-N'-(2-methylphenyl)carbamimidoyl]-2-phenylpiperazine-1-carboxamide (PubChem CID 23649368) has the molecular formula C26H25ClN6O and a molecular weight of 472.98 g/mol. Its IUPAC name is N-(4-chlorophenyl)-4-[N-cyano-N'-(2-methylphenyl)carbamimidoyl]-2-phenylpiperazine-1-carboxamide.
| Compound Name | N-(4-chlorophenyl)-4-[N-cyano-N'-(2-methylphenyl)carbamimidoyl]-2-phenylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 23649368 |
| Molecular Formula | C26H25ClN6O |
| Molecular Weight | 472.98 g/mol |
| Exact Mass | 472.18 |
| IUPAC Name | N-(4-chlorophenyl)-4-[N-cyano-N'-(2-methylphenyl)carbamimidoyl]-2-phenylpiperazine-1-carboxamide |
| SMILES | Cc1ccccc1/N=C(\NC#N)N1CCN(C(=O)Nc2ccc(Cl)cc2)C(c2ccccc2)C1 |
| InChI | InChI=1S/C26H25ClN6O/c1-19-7-5-6-10-23(19)31-25(29-18-28)32-15-16-33(24(17-32)20-8-3-2-4-9-20)26(34)30-22-13-11-21(27)12-14-22/h2-14,24H,15-17H2,1H3,(H,29,31)(H,30,34) |
| InChIKey | SCWHRLVRDTZVDK-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 83.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.98 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|