C25H27N7O3 — CID 59689922
4-[N-cyano-N'-(3-cyanophenyl)carbamimidoyl]-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-propan-2-ylpiperazine-1-carboxamide (PubChem CID 59689922) has the molecular formula C25H27N7O3 and a molecular weight of 473.54 g/mol. Its IUPAC name is 4-[N-cyano-N'-(3-cyanophenyl)carbamimidoyl]-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-propan-2-ylpiperazine-1-carboxamide.
| Compound Name | 4-[N-cyano-N'-(3-cyanophenyl)carbamimidoyl]-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-propan-2-ylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 59689922 |
| Molecular Formula | C25H27N7O3 |
| Molecular Weight | 473.54 g/mol |
| Exact Mass | 473.22 |
| IUPAC Name | 4-[N-cyano-N'-(3-cyanophenyl)carbamimidoyl]-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-propan-2-ylpiperazine-1-carboxamide |
| SMILES | CC(C)C1CN(C(=O)Nc2ccc3c(c2)OCCO3)CCN1/C(=N/c1cccc(C#N)c1)NC#N |
| InChI | InChI=1S/C25H27N7O3/c1-17(2)21-15-31(25(33)30-20-6-7-22-23(13-20)35-11-10-34-22)8-9-32(21)24(28-16-27)29-19-5-3-4-18(12-19)14-26/h3-7,12-13,17,21H,8-11,15H2,1-2H3,(H,28,29)(H,30,33) |
| InChIKey | ZPRJLAOOLFLQPQ-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 126.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.54 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|