C22H16ClFN2O4S — CID 59691987
N-[3-[3-amino-2-(2-chloro-4-fluorobenzoyl)-1-benzofuran-6-yl]phenyl]methanesulfonamide (PubChem CID 59691987) has the molecular formula C22H16ClFN2O4S and a molecular weight of 458.90 g/mol. Its IUPAC name is N-[3-[3-amino-2-(2-chloro-4-fluorobenzoyl)-1-benzofuran-6-yl]phenyl]methanesulfonamide.
| Compound Name | N-[3-[3-amino-2-(2-chloro-4-fluorobenzoyl)-1-benzofuran-6-yl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 59691987 |
| Molecular Formula | C22H16ClFN2O4S |
| Molecular Weight | 458.90 g/mol |
| Exact Mass | 458.05 |
| IUPAC Name | N-[3-[3-amino-2-(2-chloro-4-fluorobenzoyl)-1-benzofuran-6-yl]phenyl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1cccc(-c2ccc3c(N)c(C(=O)c4ccc(F)cc4Cl)oc3c2)c1 |
| InChI | InChI=1S/C22H16ClFN2O4S/c1-31(28,29)26-15-4-2-3-12(9-15)13-5-7-17-19(10-13)30-22(20(17)25)21(27)16-8-6-14(24)11-18(16)23/h2-11,26H,25H2,1H3 |
| InChIKey | RNXUDQHTDGTGID-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 102.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.90 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |