C16H18O4 — CID 59692973
tert-butyl (1R)-2-oxo-5-phenyl-3-oxabicyclo[3.1.0]hexane-1-carboxylate (PubChem CID 59692973) has the molecular formula C16H18O4 and a molecular weight of 274.32 g/mol. Its IUPAC name is tert-butyl (1R)-2-oxo-5-phenyl-3-oxabicyclo[3.1.0]hexane-1-carboxylate.
| Compound Name | tert-butyl (1R)-2-oxo-5-phenyl-3-oxabicyclo[3.1.0]hexane-1-carboxylate |
|---|---|
| PubChem CID | 59692973 |
| Molecular Formula | C16H18O4 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | tert-butyl (1R)-2-oxo-5-phenyl-3-oxabicyclo[3.1.0]hexane-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)[C@]12CC1(c1ccccc1)COC2=O |
| InChI | InChI=1S/C16H18O4/c1-14(2,3)20-13(18)16-9-15(16,10-19-12(16)17)11-7-5-4-6-8-11/h4-8H,9-10H2,1-3H3/t15?,16-/m1/s1 |
| InChIKey | KYBTVVURFXMWPO-OEMAIJDKSA-N |
| XLogP | 2.21 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|