C19H18F3N3O3 — CID 59694310
5,5-dimethyl-3-[2-methyl-4-(trifluoromethoxy)phenyl]-1-(pyridin-4-ylmethyl)imidazolidine-2,4-dione (PubChem CID 59694310) has the molecular formula C19H18F3N3O3 and a molecular weight of 393.37 g/mol. Its IUPAC name is 5,5-dimethyl-3-[2-methyl-4-(trifluoromethoxy)phenyl]-1-(pyridin-4-ylmethyl)imidazolidine-2,4-dione.
| Compound Name | 5,5-dimethyl-3-[2-methyl-4-(trifluoromethoxy)phenyl]-1-(pyridin-4-ylmethyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 59694310 |
| Molecular Formula | C19H18F3N3O3 |
| Molecular Weight | 393.37 g/mol |
| Exact Mass | 393.13 |
| IUPAC Name | 5,5-dimethyl-3-[2-methyl-4-(trifluoromethoxy)phenyl]-1-(pyridin-4-ylmethyl)imidazolidine-2,4-dione |
| SMILES | Cc1cc(OC(F)(F)F)ccc1N1C(=O)N(Cc2ccncc2)C(C)(C)C1=O |
| InChI | InChI=1S/C19H18F3N3O3/c1-12-10-14(28-19(20,21)22)4-5-15(12)25-16(26)18(2,3)24(17(25)27)11-13-6-8-23-9-7-13/h4-10H,11H2,1-3H3 |
| InChIKey | PWPSAYSOVUQPRA-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.37 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|