C17H18BrN3O6S — CID 59697997
4-[(4-bromophenyl)sulfonylamino]-N-[(2S,3R)-3-hydroxy-1-(hydroxyamino)-1-oxobutan-2-yl]benzamide (PubChem CID 59697997) has the molecular formula C17H18BrN3O6S and a molecular weight of 472.32 g/mol. Its IUPAC name is 4-[(4-bromophenyl)sulfonylamino]-N-[(2S,3R)-3-hydroxy-1-(hydroxyamino)-1-oxobutan-2-yl]benzamide.
| Compound Name | 4-[(4-bromophenyl)sulfonylamino]-N-[(2S,3R)-3-hydroxy-1-(hydroxyamino)-1-oxobutan-2-yl]benzamide |
|---|---|
| PubChem CID | 59697997 |
| Molecular Formula | C17H18BrN3O6S |
| Molecular Weight | 472.32 g/mol |
| Exact Mass | 471.01 |
| IUPAC Name | 4-[(4-bromophenyl)sulfonylamino]-N-[(2S,3R)-3-hydroxy-1-(hydroxyamino)-1-oxobutan-2-yl]benzamide |
| SMILES | C[C@@H](O)[C@H](NC(=O)c1ccc(NS(=O)(=O)c2ccc(Br)cc2)cc1)C(=O)NO |
| InChI | InChI=1S/C17H18BrN3O6S/c1-10(22)15(17(24)20-25)19-16(23)11-2-6-13(7-3-11)21-28(26,27)14-8-4-12(18)5-9-14/h2-10,15,21-22,25H,1H3,(H,19,23)(H,20,24)/t10-,15+/m1/s1 |
| InChIKey | PWMPWIOMZGWOBZ-BMIGLBTASA-N |
| XLogP | 1.23 |
| TPSA | 144.83 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.32 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|