C20H17N3OS2 — CID 59700899
5-isocyano-2-(4-methylphenyl)-6-methylsulfanyl-3-(4-methylsulfanylphenyl)pyrimidin-4-one (PubChem CID 59700899) has the molecular formula C20H17N3OS2 and a molecular weight of 379.51 g/mol. Its IUPAC name is 5-isocyano-2-(4-methylphenyl)-6-methylsulfanyl-3-(4-methylsulfanylphenyl)pyrimidin-4-one.
| Compound Name | 5-isocyano-2-(4-methylphenyl)-6-methylsulfanyl-3-(4-methylsulfanylphenyl)pyrimidin-4-one |
|---|---|
| PubChem CID | 59700899 |
| Molecular Formula | C20H17N3OS2 |
| Molecular Weight | 379.51 g/mol |
| Exact Mass | 379.08 |
| IUPAC Name | 5-isocyano-2-(4-methylphenyl)-6-methylsulfanyl-3-(4-methylsulfanylphenyl)pyrimidin-4-one |
| SMILES | [C-]#[N+]c1c(SC)nc(-c2ccc(C)cc2)n(-c2ccc(SC)cc2)c1=O |
| InChI | InChI=1S/C20H17N3OS2/c1-13-5-7-14(8-6-13)18-22-19(26-4)17(21-2)20(24)23(18)15-9-11-16(25-3)12-10-15/h5-12H,1,3-4H3 |
| InChIKey | CWOLEZIZWKIMTD-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 39.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.51 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|