C39H42Cl2N6O7S — CID 59702025
N-[4-(acetylsulfamoyl)-2,5-dichlorophenyl]-2-[4-[ethyl(2-hydroxyethyl)amino]phenyl]imino-2-[3-[7-(furan-2-yl)heptyl]-4-oxoquinazolin-2-yl]acetamide (PubChem CID 59702025) has the molecular formula C39H42Cl2N6O7S and a molecular weight of 809.77 g/mol. Its IUPAC name is N-[4-(acetylsulfamoyl)-2,5-dichlorophenyl]-2-[4-[ethyl(2-hydroxyethyl)amino]phenyl]imino-2-[3-[7-(furan-2-yl)heptyl]-4-oxoquinazolin-2-yl]acetamide.
| Compound Name | N-[4-(acetylsulfamoyl)-2,5-dichlorophenyl]-2-[4-[ethyl(2-hydroxyethyl)amino]phenyl]imino-2-[3-[7-(furan-2-yl)heptyl]-4-oxoquinazolin-2-yl]acetamide |
|---|---|
| PubChem CID | 59702025 |
| Molecular Formula | C39H42Cl2N6O7S |
| Molecular Weight | 809.77 g/mol |
| Exact Mass | 808.22 |
| IUPAC Name | N-[4-(acetylsulfamoyl)-2,5-dichlorophenyl]-2-[4-[ethyl(2-hydroxyethyl)amino]phenyl]imino-2-[3-[7-(furan-2-yl)heptyl]-4-oxoquinazolin-2-yl]acetamide |
| SMILES | CCN(CCO)c1ccc(/N=C(\C(=O)Nc2cc(Cl)c(S(=O)(=O)NC(C)=O)cc2Cl)c2nc3ccccc3c(=O)n2CCCCCCCc2ccco2)cc1 |
| InChI | InChI=1S/C39H42Cl2N6O7S/c1-3-46(21-22-48)28-18-16-27(17-19-28)42-36(38(50)44-34-24-32(41)35(25-31(34)40)55(52,53)45-26(2)49)37-43-33-15-9-8-14-30(33)39(51)47(37)20-10-6-4-5-7-12-29-13-11-23-54-29/h8-9,11,13-19,23-25,48H,3-7,10,12,20-22H2,1-2H3,(H,44,50)(H,45,49)/b42-36- |
| InChIKey | FECLQUKEXOBFHE-HCXVLTECSA-N |
| XLogP | 6.89 |
| TPSA | 176.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 809.77 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|