C24H28N6O4 — CID 59703379
(2S,6R)-2,6-dimethyl-4-[4-[(3S)-3-methylmorpholin-4-yl]-7-(4-nitrophenyl)pyrido[2,3-d]pyrimidin-2-yl]morpholine (PubChem CID 59703379) has the molecular formula C24H28N6O4 and a molecular weight of 464.53 g/mol. Its IUPAC name is (2S,6R)-2,6-dimethyl-4-[4-[(3S)-3-methylmorpholin-4-yl]-7-(4-nitrophenyl)pyrido[2,3-d]pyrimidin-2-yl]morpholine.
| Compound Name | (2S,6R)-2,6-dimethyl-4-[4-[(3S)-3-methylmorpholin-4-yl]-7-(4-nitrophenyl)pyrido[2,3-d]pyrimidin-2-yl]morpholine |
|---|---|
| PubChem CID | 59703379 |
| Molecular Formula | C24H28N6O4 |
| Molecular Weight | 464.53 g/mol |
| Exact Mass | 464.22 |
| IUPAC Name | (2S,6R)-2,6-dimethyl-4-[4-[(3S)-3-methylmorpholin-4-yl]-7-(4-nitrophenyl)pyrido[2,3-d]pyrimidin-2-yl]morpholine |
| SMILES | C[C@@H]1CN(c2nc(N3CCOC[C@@H]3C)c3ccc(-c4ccc([N+](=O)[O-])cc4)nc3n2)C[C@H](C)O1 |
| InChI | InChI=1S/C24H28N6O4/c1-15-14-33-11-10-29(15)23-20-8-9-21(18-4-6-19(7-5-18)30(31)32)25-22(20)26-24(27-23)28-12-16(2)34-17(3)13-28/h4-9,15-17H,10-14H2,1-3H3/t15-,16-,17+/m0/s1 |
| InChIKey | SHDLLCDKRPCTFH-YESZJQIVSA-N |
| XLogP | 3.44 |
| TPSA | 106.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.53 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|