C22H22FNO3S — CID 59704063
4-[5-(4-fluorophenyl)-4-(4-methoxyphenyl)thiophen-2-yl]-N-hydroxy-N-methylbutanamide (PubChem CID 59704063) has the molecular formula C22H22FNO3S and a molecular weight of 399.49 g/mol. Its IUPAC name is 4-[5-(4-fluorophenyl)-4-(4-methoxyphenyl)thiophen-2-yl]-N-hydroxy-N-methylbutanamide.
| Compound Name | 4-[5-(4-fluorophenyl)-4-(4-methoxyphenyl)thiophen-2-yl]-N-hydroxy-N-methylbutanamide |
|---|---|
| PubChem CID | 59704063 |
| Molecular Formula | C22H22FNO3S |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | 4-[5-(4-fluorophenyl)-4-(4-methoxyphenyl)thiophen-2-yl]-N-hydroxy-N-methylbutanamide |
| SMILES | COc1ccc(-c2cc(CCCC(=O)N(C)O)sc2-c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C22H22FNO3S/c1-24(26)21(25)5-3-4-19-14-20(15-8-12-18(27-2)13-9-15)22(28-19)16-6-10-17(23)11-7-16/h6-14,26H,3-5H2,1-2H3 |
| InChIKey | AEECQTFZTHKZKZ-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|