C22H26O2SSi — CID 71429313
2-[4,5-bis(4-methoxyphenyl)thiophen-2-yl]ethyl-dimethylsilane (PubChem CID 71429313) has the molecular formula C22H26O2SSi and a molecular weight of 382.60 g/mol. Its IUPAC name is 2-[4,5-bis(4-methoxyphenyl)thiophen-2-yl]ethyl-dimethylsilane.
| Compound Name | 2-[4,5-bis(4-methoxyphenyl)thiophen-2-yl]ethyl-dimethylsilane |
|---|---|
| PubChem CID | 71429313 |
| Molecular Formula | C22H26O2SSi |
| Molecular Weight | 382.60 g/mol |
| Exact Mass | 382.14 |
| IUPAC Name | 2-[4,5-bis(4-methoxyphenyl)thiophen-2-yl]ethyl-dimethylsilane |
| SMILES | COc1ccc(-c2cc(CC[SiH](C)C)sc2-c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C22H26O2SSi/c1-23-18-9-5-16(6-10-18)21-15-20(13-14-26(3)4)25-22(21)17-7-11-19(24-2)12-8-17/h5-12,15,26H,13-14H2,1-4H3 |
| InChIKey | YONPFOSDXHOPPC-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.60 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|