C24H23N3 — CID 59706650
2-[6-[(E)-2-[(4S,5R,6S)-5,6-dimethyl-4,5,6,7-tetrahydro-2H-isoindol-4-yl]ethenyl]-3-pyridinyl]benzonitrile (PubChem CID 59706650) has the molecular formula C24H23N3 and a molecular weight of 353.47 g/mol. Its IUPAC name is 2-[6-[(E)-2-[(4S,5R,6S)-5,6-dimethyl-4,5,6,7-tetrahydro-2H-isoindol-4-yl]ethenyl]-3-pyridinyl]benzonitrile.
| Compound Name | 2-[6-[(E)-2-[(4S,5R,6S)-5,6-dimethyl-4,5,6,7-tetrahydro-2H-isoindol-4-yl]ethenyl]-3-pyridinyl]benzonitrile |
|---|---|
| PubChem CID | 59706650 |
| Molecular Formula | C24H23N3 |
| Molecular Weight | 353.47 g/mol |
| Exact Mass | 353.19 |
| IUPAC Name | 2-[6-[(E)-2-[(4S,5R,6S)-5,6-dimethyl-4,5,6,7-tetrahydro-2H-isoindol-4-yl]ethenyl]-3-pyridinyl]benzonitrile |
| SMILES | C[C@H]1[C@H](/C=C/c2ccc(-c3ccccc3C#N)cn2)c2c[nH]cc2C[C@@H]1C |
| InChI | InChI=1S/C24H23N3/c1-16-11-20-13-26-15-24(20)22(17(16)2)10-9-21-8-7-19(14-27-21)23-6-4-3-5-18(23)12-25/h3-10,13-17,22,26H,11H2,1-2H3/b10-9+/t16-,17+,22-/m0/s1 |
| InChIKey | TXBLAIAPFYXOQL-CSKAXWQXSA-N |
| XLogP | 5.57 |
| TPSA | 52.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.47 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |