C25H23N3 — CID 90999971
2-[6-[2-[(5S,6R,7S)-6,7-dimethyl-5,6,7,8-tetrahydroisoquinolin-5-yl]ethenyl]-3-pyridinyl]benzonitrile (PubChem CID 90999971) has the molecular formula C25H23N3 and a molecular weight of 365.48 g/mol. Its IUPAC name is 2-[6-[2-[(5S,6R,7S)-6,7-dimethyl-5,6,7,8-tetrahydroisoquinolin-5-yl]ethenyl]-3-pyridinyl]benzonitrile.
| Compound Name | 2-[6-[2-[(5S,6R,7S)-6,7-dimethyl-5,6,7,8-tetrahydroisoquinolin-5-yl]ethenyl]-3-pyridinyl]benzonitrile |
|---|---|
| PubChem CID | 90999971 |
| Molecular Formula | C25H23N3 |
| Molecular Weight | 365.48 g/mol |
| Exact Mass | 365.19 |
| IUPAC Name | 2-[6-[2-[(5S,6R,7S)-6,7-dimethyl-5,6,7,8-tetrahydroisoquinolin-5-yl]ethenyl]-3-pyridinyl]benzonitrile |
| SMILES | C[C@H]1[C@H](C=Cc2ccc(-c3ccccc3C#N)cn2)c2ccncc2C[C@@H]1C |
| InChI | InChI=1S/C25H23N3/c1-17-13-21-15-27-12-11-25(21)23(18(17)2)10-9-22-8-7-20(16-28-22)24-6-4-3-5-19(24)14-26/h3-12,15-18,23H,13H2,1-2H3/t17-,18+,23-/m0/s1 |
| InChIKey | OVMOGZKKXFIBSC-IXFSTUDKSA-N |
| XLogP | 5.64 |
| TPSA | 49.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.48 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |