C23H21N3S — CID 90822369
2-[6-[2-[(5S,6R,7S)-5,6-dimethyl-4,5,6,7-tetrahydro-1,2-benzothiazol-7-yl]ethenyl]-3-pyridinyl]benzonitrile (PubChem CID 90822369) has the molecular formula C23H21N3S and a molecular weight of 371.51 g/mol. Its IUPAC name is 2-[6-[2-[(5S,6R,7S)-5,6-dimethyl-4,5,6,7-tetrahydro-1,2-benzothiazol-7-yl]ethenyl]-3-pyridinyl]benzonitrile.
| Compound Name | 2-[6-[2-[(5S,6R,7S)-5,6-dimethyl-4,5,6,7-tetrahydro-1,2-benzothiazol-7-yl]ethenyl]-3-pyridinyl]benzonitrile |
|---|---|
| PubChem CID | 90822369 |
| Molecular Formula | C23H21N3S |
| Molecular Weight | 371.51 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | 2-[6-[2-[(5S,6R,7S)-5,6-dimethyl-4,5,6,7-tetrahydro-1,2-benzothiazol-7-yl]ethenyl]-3-pyridinyl]benzonitrile |
| SMILES | C[C@H]1[C@H](C=Cc2ccc(-c3ccccc3C#N)cn2)c2sncc2C[C@@H]1C |
| InChI | InChI=1S/C23H21N3S/c1-15-11-19-14-26-27-23(19)21(16(15)2)10-9-20-8-7-18(13-25-20)22-6-4-3-5-17(22)12-24/h3-10,13-16,21H,11H2,1-2H3/t15-,16+,21-/m0/s1 |
| InChIKey | BALDWTWBUXITPY-MRUHUIDDSA-N |
| XLogP | 5.70 |
| TPSA | 49.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.51 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |