C11H22N2O — CID 59709243
4-tert-butyl-1-propan-2-yl-1,3-diazinan-2-one (PubChem CID 59709243) has the molecular formula C11H22N2O and a molecular weight of 198.31 g/mol. Its IUPAC name is 4-tert-butyl-1-propan-2-yl-1,3-diazinan-2-one.
| Compound Name | 4-tert-butyl-1-propan-2-yl-1,3-diazinan-2-one |
|---|---|
| PubChem CID | 59709243 |
| Molecular Formula | C11H22N2O |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.17 |
| IUPAC Name | 4-tert-butyl-1-propan-2-yl-1,3-diazinan-2-one |
| SMILES | CC(C)N1CCC(C(C)(C)C)NC1=O |
| InChI | InChI=1S/C11H22N2O/c1-8(2)13-7-6-9(11(3,4)5)12-10(13)14/h8-9H,6-7H2,1-5H3,(H,12,14) |
| InChIKey | UFJRMZYBKHNMNV-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |