C22H22ClNO6 — CID 59712312
5-[[3-[[(2-chloro-4-methoxybenzoyl)amino]methyl]-4-methoxyphenyl]methyl]-2H-furan-5-carboxylic acid (PubChem CID 59712312) has the molecular formula C22H22ClNO6 and a molecular weight of 431.87 g/mol. Its IUPAC name is 5-[[3-[[(2-chloro-4-methoxybenzoyl)amino]methyl]-4-methoxyphenyl]methyl]-2H-furan-5-carboxylic acid.
| Compound Name | 5-[[3-[[(2-chloro-4-methoxybenzoyl)amino]methyl]-4-methoxyphenyl]methyl]-2H-furan-5-carboxylic acid |
|---|---|
| PubChem CID | 59712312 |
| Molecular Formula | C22H22ClNO6 |
| Molecular Weight | 431.87 g/mol |
| Exact Mass | 431.11 |
| IUPAC Name | 5-[[3-[[(2-chloro-4-methoxybenzoyl)amino]methyl]-4-methoxyphenyl]methyl]-2H-furan-5-carboxylic acid |
| SMILES | COc1ccc(C(=O)NCc2cc(CC3(C(=O)O)C=CCO3)ccc2OC)c(Cl)c1 |
| InChI | InChI=1S/C22H22ClNO6/c1-28-16-5-6-17(18(23)11-16)20(25)24-13-15-10-14(4-7-19(15)29-2)12-22(21(26)27)8-3-9-30-22/h3-8,10-11H,9,12-13H2,1-2H3,(H,24,25)(H,26,27) |
| InChIKey | VFGCRVLUOZBTNW-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.87 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|