C23H24ClNO6 — CID 59712399
5-[[3-[[(2-chloro-4-ethoxybenzoyl)amino]methyl]-4-methoxyphenyl]methyl]-2H-furan-5-carboxylic acid (PubChem CID 59712399) has the molecular formula C23H24ClNO6 and a molecular weight of 445.90 g/mol. Its IUPAC name is 5-[[3-[[(2-chloro-4-ethoxybenzoyl)amino]methyl]-4-methoxyphenyl]methyl]-2H-furan-5-carboxylic acid.
| Compound Name | 5-[[3-[[(2-chloro-4-ethoxybenzoyl)amino]methyl]-4-methoxyphenyl]methyl]-2H-furan-5-carboxylic acid |
|---|---|
| PubChem CID | 59712399 |
| Molecular Formula | C23H24ClNO6 |
| Molecular Weight | 445.90 g/mol |
| Exact Mass | 445.13 |
| IUPAC Name | 5-[[3-[[(2-chloro-4-ethoxybenzoyl)amino]methyl]-4-methoxyphenyl]methyl]-2H-furan-5-carboxylic acid |
| SMILES | CCOc1ccc(C(=O)NCc2cc(CC3(C(=O)O)C=CCO3)ccc2OC)c(Cl)c1 |
| InChI | InChI=1S/C23H24ClNO6/c1-3-30-17-6-7-18(19(24)12-17)21(26)25-14-16-11-15(5-8-20(16)29-2)13-23(22(27)28)9-4-10-31-23/h4-9,11-12H,3,10,13-14H2,1-2H3,(H,25,26)(H,27,28) |
| InChIKey | ZSRGDLPPRMRSPD-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.90 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|