C21H23NO6 — CID 59712482
methyl 2-[acetyloxy-(2-phenylmethoxy-4-pyridinyl)methyl]oxolane-2-carboxylate (PubChem CID 59712482) has the molecular formula C21H23NO6 and a molecular weight of 385.42 g/mol. Its IUPAC name is methyl 2-[acetyloxy-(2-phenylmethoxy-4-pyridinyl)methyl]oxolane-2-carboxylate.
| Compound Name | methyl 2-[acetyloxy-(2-phenylmethoxy-4-pyridinyl)methyl]oxolane-2-carboxylate |
|---|---|
| PubChem CID | 59712482 |
| Molecular Formula | C21H23NO6 |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.15 |
| IUPAC Name | methyl 2-[acetyloxy-(2-phenylmethoxy-4-pyridinyl)methyl]oxolane-2-carboxylate |
| SMILES | COC(=O)C1(C(OC(C)=O)c2ccnc(OCc3ccccc3)c2)CCCO1 |
| InChI | InChI=1S/C21H23NO6/c1-15(23)28-19(21(20(24)25-2)10-6-12-27-21)17-9-11-22-18(13-17)26-14-16-7-4-3-5-8-16/h3-5,7-9,11,13,19H,6,10,12,14H2,1-2H3 |
| InChIKey | MZYVYFUDLGFZBZ-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 83.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |