C22H22F2N4O2 — CID 59715959
(E)-3-[4-fluoro-3-[5-fluoro-1-(1-methylpiperidin-3-yl)benzimidazol-2-yl]phenyl]-N-hydroxyprop-2-enamide (PubChem CID 59715959) has the molecular formula C22H22F2N4O2 and a molecular weight of 412.44 g/mol. Its IUPAC name is (E)-3-[4-fluoro-3-[5-fluoro-1-(1-methylpiperidin-3-yl)benzimidazol-2-yl]phenyl]-N-hydroxyprop-2-enamide.
| Compound Name | (E)-3-[4-fluoro-3-[5-fluoro-1-(1-methylpiperidin-3-yl)benzimidazol-2-yl]phenyl]-N-hydroxyprop-2-enamide |
|---|---|
| PubChem CID | 59715959 |
| Molecular Formula | C22H22F2N4O2 |
| Molecular Weight | 412.44 g/mol |
| Exact Mass | 412.17 |
| IUPAC Name | (E)-3-[4-fluoro-3-[5-fluoro-1-(1-methylpiperidin-3-yl)benzimidazol-2-yl]phenyl]-N-hydroxyprop-2-enamide |
| SMILES | CN1CCCC(n2c(-c3cc(/C=C/C(=O)NO)ccc3F)nc3cc(F)ccc32)C1 |
| InChI | InChI=1S/C22H22F2N4O2/c1-27-10-2-3-16(13-27)28-20-8-6-15(23)12-19(20)25-22(28)17-11-14(4-7-18(17)24)5-9-21(29)26-30/h4-9,11-12,16,30H,2-3,10,13H2,1H3,(H,26,29)/b9-5+ |
| InChIKey | FVHVUXCDAOAPGN-WEVVVXLNSA-N |
| XLogP | 3.77 |
| TPSA | 70.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.44 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|