C24H22Cl2N4O — CID 59716851
7,8-bis(4-chlorophenyl)-2-(2-methylpropyl)-6-prop-2-enyl-[1,2,4]triazolo[4,3-b]pyridazin-3-one (PubChem CID 59716851) has the molecular formula C24H22Cl2N4O and a molecular weight of 453.37 g/mol. Its IUPAC name is 7,8-bis(4-chlorophenyl)-2-(2-methylpropyl)-6-prop-2-enyl-[1,2,4]triazolo[4,3-b]pyridazin-3-one.
| Compound Name | 7,8-bis(4-chlorophenyl)-2-(2-methylpropyl)-6-prop-2-enyl-[1,2,4]triazolo[4,3-b]pyridazin-3-one |
|---|---|
| PubChem CID | 59716851 |
| Molecular Formula | C24H22Cl2N4O |
| Molecular Weight | 453.37 g/mol |
| Exact Mass | 452.12 |
| IUPAC Name | 7,8-bis(4-chlorophenyl)-2-(2-methylpropyl)-6-prop-2-enyl-[1,2,4]triazolo[4,3-b]pyridazin-3-one |
| SMILES | C=CCc1nn2c(=O)n(CC(C)C)nc2c(-c2ccc(Cl)cc2)c1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H22Cl2N4O/c1-4-5-20-21(16-6-10-18(25)11-7-16)22(17-8-12-19(26)13-9-17)23-28-29(14-15(2)3)24(31)30(23)27-20/h4,6-13,15H,1,5,14H2,2-3H3 |
| InChIKey | BRBSNVNXTUJORS-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 52.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.37 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|