C13H24 — CID 59716985
1,1-ditert-butyl-2-ethenylcyclopropane (PubChem CID 59716985) has the molecular formula C13H24 and a molecular weight of 180.33 g/mol. Its IUPAC name is 1,1-ditert-butyl-2-ethenylcyclopropane.
| Compound Name | 1,1-ditert-butyl-2-ethenylcyclopropane |
|---|---|
| PubChem CID | 59716985 |
| Molecular Formula | C13H24 |
| Molecular Weight | 180.33 g/mol |
| Exact Mass | 180.19 |
| IUPAC Name | 1,1-ditert-butyl-2-ethenylcyclopropane |
| SMILES | C=CC1CC1(C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C13H24/c1-8-10-9-13(10,11(2,3)4)12(5,6)7/h8,10H,1,9H2,2-7H3 |
| InChIKey | KIAFBPPSYFTHEL-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.33 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|