About benzenethiolate;gold(1+);triphenylphosphanium
benzenethiolate;gold(1+);triphenylphosphanium (PubChem CID 59718190) has the molecular formula C24H21AuPS+
and a molecular weight of 569.44 g/mol. Its IUPAC name is benzenethiolate;gold(1+);triphenylphosphanium.
Molecular Properties
| Compound Name | benzenethiolate;gold(1+);triphenylphosphanium |
| PubChem CID | 59718190 |
| Molecular Formula | C24H21AuPS+ |
| Molecular Weight | 569.44 g/mol |
| Exact Mass | 569.08 |
| IUPAC Name | benzenethiolate;gold(1+);triphenylphosphanium |
| SMILES | [Au+].[S-]c1ccccc1.c1ccc([PH+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15P.C6H6S.Au/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;7-6-4-2-1-3-5-6;/h1-15H;1-5,7H;/q;;+1 |
| InChIKey | UTIIDUGXLMYYKQ-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 569.44 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze benzenethiolate;gold(1+);triphenylphosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzenethiolate;gold(1+);triphenylphosphanium?
The IUPAC name of benzenethiolate;gold(1+);triphenylphosphanium (CID 59718190) is benzenethiolate;gold(1+);triphenylphosphanium.
What is the SMILES notation for benzenethiolate;gold(1+);triphenylphosphanium?
The canonical SMILES for benzenethiolate;gold(1+);triphenylphosphanium is [Au+].[S-]c1ccccc1.c1ccc([PH+](c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of benzenethiolate;gold(1+);triphenylphosphanium?
The InChIKey is UTIIDUGXLMYYKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15P.C6H6S.Au/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;7-6-4-2-1-3-5-6;/h1-15H;1-5,7H;/q;;+1.
What are the key properties of benzenethiolate;gold(1+);triphenylphosphanium?
benzenethiolate;gold(1+);triphenylphosphanium has a molecular weight of 569.44 g/mol, XLogP of 4.77, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for benzenethiolate;gold(1+);triphenylphosphanium is sourced from PubChem (CID 59718190), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).