About (2S)-2-[(1-butyl-5-ethyl-2-oxo-6-propylpyridine-3-carbonyl)amino]-3,3-dimethylbutanoic acid
(2S)-2-[(1-butyl-5-ethyl-2-oxo-6-propylpyridine-3-carbonyl)amino]-3,3-dimethylbutanoic acid (PubChem CID 59718870) has the molecular formula C21H34N2O4
and a molecular weight of 378.51 g/mol. Its IUPAC name is (2S)-2-[(1-butyl-5-ethyl-2-oxo-6-propylpyridine-3-carbonyl)amino]-3,3-dimethylbutanoic acid.
Molecular Properties
| Compound Name | (2S)-2-[(1-butyl-5-ethyl-2-oxo-6-propylpyridine-3-carbonyl)amino]-3,3-dimethylbutanoic acid |
| PubChem CID | 59718870 |
| Molecular Formula | C21H34N2O4 |
| Molecular Weight | 378.51 g/mol |
| Exact Mass | 378.25 |
| IUPAC Name | (2S)-2-[(1-butyl-5-ethyl-2-oxo-6-propylpyridine-3-carbonyl)amino]-3,3-dimethylbutanoic acid |
| SMILES | CCCCn1c(CCC)c(CC)cc(C(=O)N[C@H](C(=O)O)C(C)(C)C)c1=O |
| InChI | InChI=1S/C21H34N2O4/c1-7-10-12-23-16(11-8-2)14(9-3)13-15(19(23)25)18(24)22-17(20(26)27)21(4,5)6/h13,17H,7-12H2,1-6H3,(H,22,24)(H,26,27)/t17-/m1/s1 |
| InChIKey | AJMZYESHAHXPFG-QGZVFWFLSA-N |
| XLogP | 3.39 |
| TPSA | 88.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.51 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2S)-2-[(1-butyl-5-ethyl-2-oxo-6-propylpyridine-3-carbonyl)amino]-3,3-dimethylbutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-[(1-butyl-5-ethyl-2-oxo-6-propylpyridine-3-carbonyl)amino]-3,3-dimethylbutanoic acid?
The IUPAC name of (2S)-2-[(1-butyl-5-ethyl-2-oxo-6-propylpyridine-3-carbonyl)amino]-3,3-dimethylbutanoic acid (CID 59718870) is (2S)-2-[(1-butyl-5-ethyl-2-oxo-6-propylpyridine-3-carbonyl)amino]-3,3-dimethylbutanoic acid.
What is the SMILES notation for (2S)-2-[(1-butyl-5-ethyl-2-oxo-6-propylpyridine-3-carbonyl)amino]-3,3-dimethylbutanoic acid?
The canonical SMILES for (2S)-2-[(1-butyl-5-ethyl-2-oxo-6-propylpyridine-3-carbonyl)amino]-3,3-dimethylbutanoic acid is CCCCn1c(CCC)c(CC)cc(C(=O)N[C@H](C(=O)O)C(C)(C)C)c1=O.
What is the InChIKey of (2S)-2-[(1-butyl-5-ethyl-2-oxo-6-propylpyridine-3-carbonyl)amino]-3,3-dimethylbutanoic acid?
The InChIKey is AJMZYESHAHXPFG-QGZVFWFLSA-N. The full InChI is InChI=1S/C21H34N2O4/c1-7-10-12-23-16(11-8-2)14(9-3)13-15(19(23)25)18(24)22-17(20(26)27)21(4,5)6/h13,17H,7-12H2,1-6H3,(H,22,24)(H,26,27)/t17-/m1/s1.
What are the key properties of (2S)-2-[(1-butyl-5-ethyl-2-oxo-6-propylpyridine-3-carbonyl)amino]-3,3-dimethylbutanoic acid?
(2S)-2-[(1-butyl-5-ethyl-2-oxo-6-propylpyridine-3-carbonyl)amino]-3,3-dimethylbutanoic acid has a molecular weight of 378.51 g/mol, XLogP of 3.39, 9 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-[(1-butyl-5-ethyl-2-oxo-6-propylpyridine-3-carbonyl)amino]-3,3-dimethylbutanoic acid is sourced from PubChem (CID 59718870), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).