C21H31N5 — CID 59721721
N'-[4-[(6-amino-4-methyl-2-pyridinyl)methyl]pyrrolidin-3-yl]-N-benzyl-N'-methylethane-1,2-diamine (PubChem CID 59721721) has the molecular formula C21H31N5 and a molecular weight of 353.51 g/mol. Its IUPAC name is N'-[4-[(6-amino-4-methyl-2-pyridinyl)methyl]pyrrolidin-3-yl]-N-benzyl-N'-methylethane-1,2-diamine.
| Compound Name | N'-[4-[(6-amino-4-methyl-2-pyridinyl)methyl]pyrrolidin-3-yl]-N-benzyl-N'-methylethane-1,2-diamine |
|---|---|
| PubChem CID | 59721721 |
| Molecular Formula | C21H31N5 |
| Molecular Weight | 353.51 g/mol |
| Exact Mass | 353.26 |
| IUPAC Name | N'-[4-[(6-amino-4-methyl-2-pyridinyl)methyl]pyrrolidin-3-yl]-N-benzyl-N'-methylethane-1,2-diamine |
| SMILES | Cc1cc(N)nc(CC2CNCC2N(C)CCNCc2ccccc2)c1 |
| InChI | InChI=1S/C21H31N5/c1-16-10-19(25-21(22)11-16)12-18-14-24-15-20(18)26(2)9-8-23-13-17-6-4-3-5-7-17/h3-7,10-11,18,20,23-24H,8-9,12-15H2,1-2H3,(H2,22,25) |
| InChIKey | YVWZGXMSDMNIJX-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 66.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.51 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|