C18H17N3O2 — CID 59723685
5-[(2,5-dimethyl-1-phenylpyrrol-3-yl)methylidene]-2-methylidene-1,3-diazinane-4,6-dione (PubChem CID 59723685) has the molecular formula C18H17N3O2 and a molecular weight of 307.35 g/mol. Its IUPAC name is 5-[(2,5-dimethyl-1-phenylpyrrol-3-yl)methylidene]-2-methylidene-1,3-diazinane-4,6-dione.
| Compound Name | 5-[(2,5-dimethyl-1-phenylpyrrol-3-yl)methylidene]-2-methylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 59723685 |
| Molecular Formula | C18H17N3O2 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.13 |
| IUPAC Name | 5-[(2,5-dimethyl-1-phenylpyrrol-3-yl)methylidene]-2-methylidene-1,3-diazinane-4,6-dione |
| SMILES | C=c1[nH]c(=O)c(=Cc2cc(C)n(-c3ccccc3)c2C)c(=O)[nH]1 |
| InChI | InChI=1S/C18H17N3O2/c1-11-9-14(10-16-17(22)19-13(3)20-18(16)23)12(2)21(11)15-7-5-4-6-8-15/h4-10H,3H2,1-2H3,(H,19,22)(H,20,23) |
| InChIKey | AWPUUSPIOHXDHM-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 70.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|