C24H29N3O3S — CID 59723845
2-methyl-2-[4-[3-(4-oxo-2-propylquinazolin-3-yl)propylamino]phenyl]sulfanylpropanoic acid (PubChem CID 59723845) has the molecular formula C24H29N3O3S and a molecular weight of 439.58 g/mol. Its IUPAC name is 2-methyl-2-[4-[3-(4-oxo-2-propylquinazolin-3-yl)propylamino]phenyl]sulfanylpropanoic acid.
| Compound Name | 2-methyl-2-[4-[3-(4-oxo-2-propylquinazolin-3-yl)propylamino]phenyl]sulfanylpropanoic acid |
|---|---|
| PubChem CID | 59723845 |
| Molecular Formula | C24H29N3O3S |
| Molecular Weight | 439.58 g/mol |
| Exact Mass | 439.19 |
| IUPAC Name | 2-methyl-2-[4-[3-(4-oxo-2-propylquinazolin-3-yl)propylamino]phenyl]sulfanylpropanoic acid |
| SMILES | CCCc1nc2ccccc2c(=O)n1CCCNc1ccc(SC(C)(C)C(=O)O)cc1 |
| InChI | InChI=1S/C24H29N3O3S/c1-4-8-21-26-20-10-6-5-9-19(20)22(28)27(21)16-7-15-25-17-11-13-18(14-12-17)31-24(2,3)23(29)30/h5-6,9-14,25H,4,7-8,15-16H2,1-3H3,(H,29,30) |
| InChIKey | WABWVUOVYWVAJK-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.58 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|