C24H33N5O4 — CID 59723923
2-[4-[3-(5-ethyl-1-methyl-7-oxo-3-propylpyrazolo[4,5-d]pyrimidin-6-yl)propylamino]phenoxy]-2-methylpropanoic acid (PubChem CID 59723923) has the molecular formula C24H33N5O4 and a molecular weight of 455.56 g/mol. Its IUPAC name is 2-[4-[3-(5-ethyl-1-methyl-7-oxo-3-propylpyrazolo[4,5-d]pyrimidin-6-yl)propylamino]phenoxy]-2-methylpropanoic acid.
| Compound Name | 2-[4-[3-(5-ethyl-1-methyl-7-oxo-3-propylpyrazolo[4,5-d]pyrimidin-6-yl)propylamino]phenoxy]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 59723923 |
| Molecular Formula | C24H33N5O4 |
| Molecular Weight | 455.56 g/mol |
| Exact Mass | 455.25 |
| IUPAC Name | 2-[4-[3-(5-ethyl-1-methyl-7-oxo-3-propylpyrazolo[4,5-d]pyrimidin-6-yl)propylamino]phenoxy]-2-methylpropanoic acid |
| SMILES | CCCc1nn(C)c2c(=O)n(CCCNc3ccc(OC(C)(C)C(=O)O)cc3)c(CC)nc12 |
| InChI | InChI=1S/C24H33N5O4/c1-6-9-18-20-21(28(5)27-18)22(30)29(19(7-2)26-20)15-8-14-25-16-10-12-17(13-11-16)33-24(3,4)23(31)32/h10-13,25H,6-9,14-15H2,1-5H3,(H,31,32) |
| InChIKey | AZFOPHMLIPGYEF-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 111.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.56 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|