C25H19F2N7O3 — CID 59726901
9-(6,8-difluoro-3,4-dihydro-2H-chromen-4-yl)-7-(3-hydroxypropyl)-2-(6-isocyanobenzimidazol-1-yl)purin-8-one (PubChem CID 59726901) has the molecular formula C25H19F2N7O3 and a molecular weight of 503.47 g/mol. Its IUPAC name is 9-(6,8-difluoro-3,4-dihydro-2H-chromen-4-yl)-7-(3-hydroxypropyl)-2-(6-isocyanobenzimidazol-1-yl)purin-8-one.
| Compound Name | 9-(6,8-difluoro-3,4-dihydro-2H-chromen-4-yl)-7-(3-hydroxypropyl)-2-(6-isocyanobenzimidazol-1-yl)purin-8-one |
|---|---|
| PubChem CID | 59726901 |
| Molecular Formula | C25H19F2N7O3 |
| Molecular Weight | 503.47 g/mol |
| Exact Mass | 503.15 |
| IUPAC Name | 9-(6,8-difluoro-3,4-dihydro-2H-chromen-4-yl)-7-(3-hydroxypropyl)-2-(6-isocyanobenzimidazol-1-yl)purin-8-one |
| SMILES | [C-]#[N+]c1ccc2ncn(-c3ncc4c(n3)n(C3CCOc5c(F)cc(F)cc53)c(=O)n4CCCO)c2c1 |
| InChI | InChI=1S/C25H19F2N7O3/c1-28-15-3-4-18-20(11-15)33(13-30-18)24-29-12-21-23(31-24)34(25(36)32(21)6-2-7-35)19-5-8-37-22-16(19)9-14(26)10-17(22)27/h3-4,9-13,19,35H,2,5-8H2 |
| InChIKey | KBOWETQVMBADNT-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 104.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.47 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|