C29H28N8O2 — CID 59727112
7-[2-(cyclopentylamino)ethyl]-9-(3,4-dihydro-2H-chromen-4-yl)-2-(6-isocyanobenzimidazol-1-yl)purin-8-one (PubChem CID 59727112) has the molecular formula C29H28N8O2 and a molecular weight of 520.60 g/mol. Its IUPAC name is 7-[2-(cyclopentylamino)ethyl]-9-(3,4-dihydro-2H-chromen-4-yl)-2-(6-isocyanobenzimidazol-1-yl)purin-8-one.
| Compound Name | 7-[2-(cyclopentylamino)ethyl]-9-(3,4-dihydro-2H-chromen-4-yl)-2-(6-isocyanobenzimidazol-1-yl)purin-8-one |
|---|---|
| PubChem CID | 59727112 |
| Molecular Formula | C29H28N8O2 |
| Molecular Weight | 520.60 g/mol |
| Exact Mass | 520.23 |
| IUPAC Name | 7-[2-(cyclopentylamino)ethyl]-9-(3,4-dihydro-2H-chromen-4-yl)-2-(6-isocyanobenzimidazol-1-yl)purin-8-one |
| SMILES | [C-]#[N+]c1ccc2ncn(-c3ncc4c(n3)n(C3CCOc5ccccc53)c(=O)n4CCNC3CCCC3)c2c1 |
| InChI | InChI=1S/C29H28N8O2/c1-30-20-10-11-22-24(16-20)36(18-33-22)28-32-17-25-27(34-28)37(23-12-15-39-26-9-5-4-8-21(23)26)29(38)35(25)14-13-31-19-6-2-3-7-19/h4-5,8-11,16-19,23,31H,2-3,6-7,12-15H2 |
| InChIKey | DHBYZPDKRYNVCK-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 96.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.60 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|