C26H27N7O3 — CID 89193078
2-(6-aminobenzimidazol-1-yl)-9-[(1R,4R)-4-hydroxy-1,2,3,4-tetrahydronaphthalen-1-yl]-7-(3-methoxypropyl)purin-8-one (PubChem CID 89193078) has the molecular formula C26H27N7O3 and a molecular weight of 485.55 g/mol. Its IUPAC name is 2-(6-aminobenzimidazol-1-yl)-9-[(1R,4R)-4-hydroxy-1,2,3,4-tetrahydronaphthalen-1-yl]-7-(3-methoxypropyl)purin-8-one.
| Compound Name | 2-(6-aminobenzimidazol-1-yl)-9-[(1R,4R)-4-hydroxy-1,2,3,4-tetrahydronaphthalen-1-yl]-7-(3-methoxypropyl)purin-8-one |
|---|---|
| PubChem CID | 89193078 |
| Molecular Formula | C26H27N7O3 |
| Molecular Weight | 485.55 g/mol |
| Exact Mass | 485.22 |
| IUPAC Name | 2-(6-aminobenzimidazol-1-yl)-9-[(1R,4R)-4-hydroxy-1,2,3,4-tetrahydronaphthalen-1-yl]-7-(3-methoxypropyl)purin-8-one |
| SMILES | COCCCn1c(=O)n([C@@H]2CC[C@@H](O)c3ccccc32)c2nc(-n3cnc4ccc(N)cc43)ncc21 |
| InChI | InChI=1S/C26H27N7O3/c1-36-12-4-11-31-22-14-28-25(32-15-29-19-8-7-16(27)13-21(19)32)30-24(22)33(26(31)35)20-9-10-23(34)18-6-3-2-5-17(18)20/h2-3,5-8,13-15,20,23,34H,4,9-12,27H2,1H3/t20-,23-/m1/s1 |
| InChIKey | GNEALJARELOFOQ-NFBKMPQASA-N |
| XLogP | 2.97 |
| TPSA | 126.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.55 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|