C31H29NO5S — CID 59727214
2-ethyl-2-[[4-[4-[2-(6-methoxynaphthalen-2-yl)ethynyl]phenyl]phenyl]sulfonylamino]butanoic acid (PubChem CID 59727214) has the molecular formula C31H29NO5S and a molecular weight of 527.64 g/mol. Its IUPAC name is 2-ethyl-2-[[4-[4-[2-(6-methoxynaphthalen-2-yl)ethynyl]phenyl]phenyl]sulfonylamino]butanoic acid.
| Compound Name | 2-ethyl-2-[[4-[4-[2-(6-methoxynaphthalen-2-yl)ethynyl]phenyl]phenyl]sulfonylamino]butanoic acid |
|---|---|
| PubChem CID | 59727214 |
| Molecular Formula | C31H29NO5S |
| Molecular Weight | 527.64 g/mol |
| Exact Mass | 527.18 |
| IUPAC Name | 2-ethyl-2-[[4-[4-[2-(6-methoxynaphthalen-2-yl)ethynyl]phenyl]phenyl]sulfonylamino]butanoic acid |
| SMILES | CCC(CC)(NS(=O)(=O)c1ccc(-c2ccc(C#Cc3ccc4cc(OC)ccc4c3)cc2)cc1)C(=O)O |
| InChI | InChI=1S/C31H29NO5S/c1-4-31(5-2,30(33)34)32-38(35,36)29-18-15-25(16-19-29)24-11-8-22(9-12-24)6-7-23-10-13-27-21-28(37-3)17-14-26(27)20-23/h8-21,32H,4-5H2,1-3H3,(H,33,34) |
| InChIKey | KYDLCDYSRTXVOT-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.64 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|