C17H24ClN3 — CID 59728205
N-[(2-butyl-1H-imidazol-5-yl)methyl]-3-chloro-N-propan-2-ylaniline (PubChem CID 59728205) has the molecular formula C17H24ClN3 and a molecular weight of 305.85 g/mol. Its IUPAC name is N-[(2-butyl-1H-imidazol-5-yl)methyl]-3-chloro-N-propan-2-ylaniline.
| Compound Name | N-[(2-butyl-1H-imidazol-5-yl)methyl]-3-chloro-N-propan-2-ylaniline |
|---|---|
| PubChem CID | 59728205 |
| Molecular Formula | C17H24ClN3 |
| Molecular Weight | 305.85 g/mol |
| Exact Mass | 305.17 |
| IUPAC Name | N-[(2-butyl-1H-imidazol-5-yl)methyl]-3-chloro-N-propan-2-ylaniline |
| SMILES | CCCCc1ncc(CN(c2cccc(Cl)c2)C(C)C)[nH]1 |
| InChI | InChI=1S/C17H24ClN3/c1-4-5-9-17-19-11-15(20-17)12-21(13(2)3)16-8-6-7-14(18)10-16/h6-8,10-11,13H,4-5,9,12H2,1-3H3,(H,19,20) |
| InChIKey | UUZICVPKHYSURG-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.85 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |