C26H29BN2V- — CID 59730721
CID 59730721 (PubChem CID 59730721) has the molecular formula C26H29BN2V- and a molecular weight of 431.29 g/mol.
| Compound Name | CID 59730721 |
|---|---|
| PubChem CID | 59730721 |
| Molecular Formula | C26H29BN2V- |
| Molecular Weight | 431.29 g/mol |
| Exact Mass | 431.19 |
| IUPAC Name | — |
| SMILES | [NH-]CC1(c2ccccc2)CCN(C[B]C(c2ccccc2)c2ccccc2)CC1.[V] |
| InChI | InChI=1S/C26H29BN2.V/c28-20-26(24-14-8-3-9-15-24)16-18-29(19-17-26)21-27-25(22-10-4-1-5-11-22)23-12-6-2-7-13-23;/h1-15,25,28H,16-21H2;/q-1; |
| InChIKey | WUXLPFGYQOOZCD-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 27.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.29 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|