C24H23N3O4 — CID 59731017
1-(7-hydroxy-5,6,7,8-tetrahydronaphthalen-1-yl)-3-[[3-(3-nitrophenyl)phenyl]methyl]urea (PubChem CID 59731017) has the molecular formula C24H23N3O4 and a molecular weight of 417.47 g/mol. Its IUPAC name is 1-(7-hydroxy-5,6,7,8-tetrahydronaphthalen-1-yl)-3-[[3-(3-nitrophenyl)phenyl]methyl]urea.
| Compound Name | 1-(7-hydroxy-5,6,7,8-tetrahydronaphthalen-1-yl)-3-[[3-(3-nitrophenyl)phenyl]methyl]urea |
|---|---|
| PubChem CID | 59731017 |
| Molecular Formula | C24H23N3O4 |
| Molecular Weight | 417.47 g/mol |
| Exact Mass | 417.17 |
| IUPAC Name | 1-(7-hydroxy-5,6,7,8-tetrahydronaphthalen-1-yl)-3-[[3-(3-nitrophenyl)phenyl]methyl]urea |
| SMILES | O=C(NCc1cccc(-c2cccc([N+](=O)[O-])c2)c1)Nc1cccc2c1CC(O)CC2 |
| InChI | InChI=1S/C24H23N3O4/c28-21-11-10-17-5-3-9-23(22(17)14-21)26-24(29)25-15-16-4-1-6-18(12-16)19-7-2-8-20(13-19)27(30)31/h1-9,12-13,21,28H,10-11,14-15H2,(H2,25,26,29) |
| InChIKey | HGHXXUVDVJOHQQ-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 104.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.47 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|