C21H20F6N2O3 — CID 10367070
1-[2-[3,5-bis(trifluoromethyl)phenoxy]ethyl]-3-(7-hydroxy-5,6,7,8-tetrahydronaphthalen-1-yl)urea (PubChem CID 10367070) has the molecular formula C21H20F6N2O3 and a molecular weight of 462.39 g/mol. Its IUPAC name is 1-[2-[3,5-bis(trifluoromethyl)phenoxy]ethyl]-3-(7-hydroxy-5,6,7,8-tetrahydronaphthalen-1-yl)urea.
| Compound Name | 1-[2-[3,5-bis(trifluoromethyl)phenoxy]ethyl]-3-(7-hydroxy-5,6,7,8-tetrahydronaphthalen-1-yl)urea |
|---|---|
| PubChem CID | 10367070 |
| Molecular Formula | C21H20F6N2O3 |
| Molecular Weight | 462.39 g/mol |
| Exact Mass | 462.14 |
| IUPAC Name | 1-[2-[3,5-bis(trifluoromethyl)phenoxy]ethyl]-3-(7-hydroxy-5,6,7,8-tetrahydronaphthalen-1-yl)urea |
| SMILES | O=C(NCCOc1cc(C(F)(F)F)cc(C(F)(F)F)c1)Nc1cccc2c1CC(O)CC2 |
| InChI | InChI=1S/C21H20F6N2O3/c22-20(23,24)13-8-14(21(25,26)27)10-16(9-13)32-7-6-28-19(31)29-18-3-1-2-12-4-5-15(30)11-17(12)18/h1-3,8-10,15,30H,4-7,11H2,(H2,28,29,31) |
| InChIKey | FLHZAJVSONDFGT-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.39 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|